C21H14N2O4 — CID 175310610
3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-5-phenyl-1H-pyrrol-2-one (PubChem CID 175310610) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-5-phenyl-1H-pyrrol-2-one.
| Compound Name | 3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-5-phenyl-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 175310610 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-5-phenyl-1H-pyrrol-2-one |
| SMILES | O=C1NC(c2ccccc2)=CC1=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C21H14N2O4/c24-21-16(13-19(22-21)14-4-2-1-3-5-14)12-18-10-11-20(27-18)15-6-8-17(9-7-15)23(25)26/h1-13H,(H,22,24) |
| InChIKey | OMAZMDAJYJKSBT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|