C22H43N5O6 — CID 175312756
N-[2-(prop-2-enoylamino)ethyl]-2-[2-(1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)ethylamino]propanamide (PubChem CID 175312756) has the molecular formula C22H43N5O6 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[2-(prop-2-enoylamino)ethyl]-2-[2-(1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)ethylamino]propanamide.
| Compound Name | N-[2-(prop-2-enoylamino)ethyl]-2-[2-(1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 175312756 |
| Molecular Formula | C22H43N5O6 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.32 |
| IUPAC Name | N-[2-(prop-2-enoylamino)ethyl]-2-[2-(1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl)ethylamino]propanamide |
| SMILES | C=CC(=O)NCCNC(=O)C(C)NCCN1CCOCCOCCNCCOCCOCC1 |
| InChI | InChI=1S/C22H43N5O6/c1-3-21(28)25-4-5-26-22(29)20(2)24-6-9-27-10-14-32-18-16-30-12-7-23-8-13-31-17-19-33-15-11-27/h3,20,23-24H,1,4-19H2,2H3,(H,25,28)(H,26,29) |
| InChIKey | MABLYLUXMQNDQJ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|