C10H10ClFN4O2 — CID 175313862
1-(2-chloro-5-fluoropyrimidin-4-yl)-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 175313862) has the molecular formula C10H10ClFN4O2 and a molecular weight of 272.67 g/mol. Its IUPAC name is 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175313862 |
| Molecular Formula | C10H10ClFN4O2 |
| Molecular Weight | 272.67 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-(2-chloro-5-fluoropyrimidin-4-yl)-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)C1C(=O)NC(=O)N1c1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H10ClFN4O2/c1-4(2)6-8(17)15-10(18)16(6)7-5(12)3-13-9(11)14-7/h3-4,6H,1-2H3,(H,15,17,18) |
| InChIKey | DILKOXQTLKMWED-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|