C11H15ClFN3 — CID 79076306
2-chloro-4-(2,5-dimethylpiperidin-1-yl)-5-fluoropyrimidine (PubChem CID 79076306) has the molecular formula C11H15ClFN3 and a molecular weight of 243.71 g/mol. Its IUPAC name is 2-chloro-4-(2,5-dimethylpiperidin-1-yl)-5-fluoropyrimidine.
| Compound Name | 2-chloro-4-(2,5-dimethylpiperidin-1-yl)-5-fluoropyrimidine |
|---|---|
| PubChem CID | 79076306 |
| Molecular Formula | C11H15ClFN3 |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-chloro-4-(2,5-dimethylpiperidin-1-yl)-5-fluoropyrimidine |
| SMILES | CC1CCC(C)N(c2nc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C11H15ClFN3/c1-7-3-4-8(2)16(6-7)10-9(13)5-14-11(12)15-10/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | RCZCPQLUDFJPTG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |