About ethyl acetate;3-triethoxysilylpropanoic acid
ethyl acetate;3-triethoxysilylpropanoic acid (PubChem CID 175314262) has the molecular formula C13H28O7Si
and a molecular weight of 324.45 g/mol. Its IUPAC name is ethyl acetate;3-triethoxysilylpropanoic acid.
Molecular Properties
| Compound Name | ethyl acetate;3-triethoxysilylpropanoic acid |
| PubChem CID | 175314262 |
| Molecular Formula | C13H28O7Si |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl acetate;3-triethoxysilylpropanoic acid |
| SMILES | CCOC(C)=O.CCO[Si](CCC(=O)O)(OCC)OCC |
| InChI | InChI=1S/C9H20O5Si.C4H8O2/c1-4-12-15(13-5-2,14-6-3)8-7-9(10)11;1-3-6-4(2)5/h4-8H2,1-3H3,(H,10,11);3H2,1-2H3 |
| InChIKey | TVUKGDHMJYXBMT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;3-triethoxysilylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;3-triethoxysilylpropanoic acid?
The IUPAC name of ethyl acetate;3-triethoxysilylpropanoic acid (CID 175314262) is ethyl acetate;3-triethoxysilylpropanoic acid.
What is the SMILES notation for ethyl acetate;3-triethoxysilylpropanoic acid?
The canonical SMILES for ethyl acetate;3-triethoxysilylpropanoic acid is CCOC(C)=O.CCO[Si](CCC(=O)O)(OCC)OCC.
What is the InChIKey of ethyl acetate;3-triethoxysilylpropanoic acid?
The InChIKey is TVUKGDHMJYXBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O5Si.C4H8O2/c1-4-12-15(13-5-2,14-6-3)8-7-9(10)11;1-3-6-4(2)5/h4-8H2,1-3H3,(H,10,11);3H2,1-2H3.
What are the key properties of ethyl acetate;3-triethoxysilylpropanoic acid?
ethyl acetate;3-triethoxysilylpropanoic acid has a molecular weight of 324.45 g/mol, XLogP of 2.08, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;3-triethoxysilylpropanoic acid is sourced from PubChem (CID 175314262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).