C10H8N2O3S — CID 175315893
1-(3,4-dicyanophenyl)ethanesulfonic acid (PubChem CID 175315893) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 1-(3,4-dicyanophenyl)ethanesulfonic acid.
| Compound Name | 1-(3,4-dicyanophenyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 175315893 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1-(3,4-dicyanophenyl)ethanesulfonic acid |
| SMILES | CC(c1ccc(C#N)c(C#N)c1)S(=O)(=O)O |
| InChI | InChI=1S/C10H8N2O3S/c1-7(16(13,14)15)8-2-3-9(5-11)10(4-8)6-12/h2-4,7H,1H3,(H,13,14,15) |
| InChIKey | YFNQKPQMVMSENE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|