About carbamoyl 2-bromobenzenesulfonate
carbamoyl 2-bromobenzenesulfonate (PubChem CID 175318576) has the molecular formula C7H6BrNO4S
and a molecular weight of 280.10 g/mol. Its IUPAC name is carbamoyl 2-bromobenzenesulfonate.
Molecular Properties
| Compound Name | carbamoyl 2-bromobenzenesulfonate |
| PubChem CID | 175318576 |
| Molecular Formula | C7H6BrNO4S |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | carbamoyl 2-bromobenzenesulfonate |
| SMILES | NC(=O)OS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C7H6BrNO4S/c8-5-3-1-2-4-6(5)14(11,12)13-7(9)10/h1-4H,(H2,9,10) |
| InChIKey | SLEZPNNADZYTJX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl 2-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl 2-bromobenzenesulfonate?
The IUPAC name of carbamoyl 2-bromobenzenesulfonate (CID 175318576) is carbamoyl 2-bromobenzenesulfonate.
What is the SMILES notation for carbamoyl 2-bromobenzenesulfonate?
The canonical SMILES for carbamoyl 2-bromobenzenesulfonate is NC(=O)OS(=O)(=O)c1ccccc1Br.
What is the InChIKey of carbamoyl 2-bromobenzenesulfonate?
The InChIKey is SLEZPNNADZYTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO4S/c8-5-3-1-2-4-6(5)14(11,12)13-7(9)10/h1-4H,(H2,9,10).
What are the key properties of carbamoyl 2-bromobenzenesulfonate?
carbamoyl 2-bromobenzenesulfonate has a molecular weight of 280.10 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl 2-bromobenzenesulfonate is sourced from PubChem (CID 175318576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).