C13H11Br2N3O4S2 — CID 19755154
1,1-bis[(2-bromophenyl)sulfonyl]guanidine (PubChem CID 19755154) has the molecular formula C13H11Br2N3O4S2 and a molecular weight of 497.19 g/mol. Its IUPAC name is 1,1-bis[(2-bromophenyl)sulfonyl]guanidine.
| Compound Name | 1,1-bis[(2-bromophenyl)sulfonyl]guanidine |
|---|---|
| PubChem CID | 19755154 |
| Molecular Formula | C13H11Br2N3O4S2 |
| Molecular Weight | 497.19 g/mol |
| Exact Mass | 494.86 |
| IUPAC Name | 1,1-bis[(2-bromophenyl)sulfonyl]guanidine |
| SMILES | [H]/N=C(\N)N(S(=O)(=O)c1ccccc1Br)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C13H11Br2N3O4S2/c14-9-5-1-3-7-11(9)23(19,20)18(13(16)17)24(21,22)12-8-4-2-6-10(12)15/h1-8H,(H3,16,17) |
| InChIKey | CQFRRSIAJPYSSR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|