C16H24O2Si — CID 175319879
ethyl-dimethyl-phenylsilane;(2E,4E)-hexa-2,4-dienoic acid (PubChem CID 175319879) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is ethyl-dimethyl-phenylsilane;(2E,4E)-hexa-2,4-dienoic acid.
| Compound Name | ethyl-dimethyl-phenylsilane;(2E,4E)-hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 175319879 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl-dimethyl-phenylsilane;(2E,4E)-hexa-2,4-dienoic acid |
| SMILES | C/C=C/C=C/C(=O)O.CC[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C10H16Si.C6H8O2/c1-4-11(2,3)10-8-6-5-7-9-10;1-2-3-4-5-6(7)8/h5-9H,4H2,1-3H3;2-5H,1H3,(H,7,8)/b;3-2+,5-4+ |
| InChIKey | DZGKNOAQHLHLPC-PLKIVWSFSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|