C19H20IN5O — CID 175320820
6-[2-(1-iodoethoxy)ethenyl]-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 175320820) has the molecular formula C19H20IN5O and a molecular weight of 461.31 g/mol. Its IUPAC name is 6-[2-(1-iodoethoxy)ethenyl]-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-[2-(1-iodoethoxy)ethenyl]-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 175320820 |
| Molecular Formula | C19H20IN5O |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 6-[2-(1-iodoethoxy)ethenyl]-N-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | CC(I)OC=Cc1cc(NCc2ccc(-c3cnn(C)c3)cc2)ncn1 |
| InChI | InChI=1S/C19H20IN5O/c1-14(20)26-8-7-18-9-19(23-13-22-18)21-10-15-3-5-16(6-4-15)17-11-24-25(2)12-17/h3-9,11-14H,10H2,1-2H3,(H,21,22,23) |
| InChIKey | PAOREKMLISQZRT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|