C15H27N3O5Si — CID 175321435
4-amino-1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-(1-hydroxy-2,2-dimethylpropyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 175321435) has the molecular formula C15H27N3O5Si and a molecular weight of 357.48 g/mol. Its IUPAC name is 4-amino-1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-(1-hydroxy-2,2-dimethylpropyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-(1-hydroxy-2,2-dimethylpropyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 175321435 |
| Molecular Formula | C15H27N3O5Si |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-amino-1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-(1-hydroxy-2,2-dimethylpropyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C[SiH](C)[C@@]1(n2ccc(N)nc2=O)O[C@H](C(O)C(C)(C)C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H27N3O5Si/c1-14(2,3)12(21)10-9(19)11(20)15(23-10,24(4)5)18-7-6-8(16)17-13(18)22/h6-7,9-12,19-21,24H,1-5H3,(H2,16,17,22)/t9-,10+,11-,12?,15+/m1/s1 |
| InChIKey | BKDJZKLTBXAPTP-DHOKYPLCSA-N |
| XLogP | -0.97 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|