C13H16FNO — CID 175323145
(3,3-dimethyl-2H-pyrrol-1-yl)-(4-fluorophenyl)methanol (PubChem CID 175323145) has the molecular formula C13H16FNO and a molecular weight of 221.28 g/mol. Its IUPAC name is (3,3-dimethyl-2H-pyrrol-1-yl)-(4-fluorophenyl)methanol.
| Compound Name | (3,3-dimethyl-2H-pyrrol-1-yl)-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 175323145 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3,3-dimethyl-2H-pyrrol-1-yl)-(4-fluorophenyl)methanol |
| SMILES | CC1(C)C=CN(C(O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H16FNO/c1-13(2)7-8-15(9-13)12(16)10-3-5-11(14)6-4-10/h3-8,12,16H,9H2,1-2H3 |
| InChIKey | UTFWQMSRIBGLGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |