About benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide
benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide (PubChem CID 175323631) has the molecular formula C28H42N2O2
and a molecular weight of 438.66 g/mol. Its IUPAC name is benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide.
Molecular Properties
| Compound Name | benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide |
| PubChem CID | 175323631 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide |
| SMILES | CCCC(=O)N(c1ccccc1N(C(=O)CCC)C(C)(C)C)C(C)(C)C.c1ccccc1 |
| InChI | InChI=1S/C22H36N2O2.C6H6/c1-9-13-19(25)23(21(3,4)5)17-15-11-12-16-18(17)24(22(6,7)8)20(26)14-10-2;1-2-4-6-5-3-1/h11-12,15-16H,9-10,13-14H2,1-8H3;1-6H |
| InChIKey | RXNPVVPGBUALLO-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide?
The IUPAC name of benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide (CID 175323631) is benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide.
What is the SMILES notation for benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide?
The canonical SMILES for benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide is CCCC(=O)N(c1ccccc1N(C(=O)CCC)C(C)(C)C)C(C)(C)C.c1ccccc1.
What is the InChIKey of benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide?
The InChIKey is RXNPVVPGBUALLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O2.C6H6/c1-9-13-19(25)23(21(3,4)5)17-15-11-12-16-18(17)24(22(6,7)8)20(26)14-10-2;1-2-4-6-5-3-1/h11-12,15-16H,9-10,13-14H2,1-8H3;1-6H.
What are the key properties of benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide?
benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide has a molecular weight of 438.66 g/mol, XLogP of 7.24, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-[2-[butanoyl(tert-butyl)amino]phenyl]-N-tert-butylbutanamide is sourced from PubChem (CID 175323631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).