About undecan-3-yl 2-ethylpiperidine-1-carboxylate
undecan-3-yl 2-ethylpiperidine-1-carboxylate (PubChem CID 175325020) has the molecular formula C19H37NO2
and a molecular weight of 311.51 g/mol. Its IUPAC name is undecan-3-yl 2-ethylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | undecan-3-yl 2-ethylpiperidine-1-carboxylate |
| PubChem CID | 175325020 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | undecan-3-yl 2-ethylpiperidine-1-carboxylate |
| SMILES | CCCCCCCCC(CC)OC(=O)N1CCCCC1CC |
| InChI | InChI=1S/C19H37NO2/c1-4-7-8-9-10-11-15-18(6-3)22-19(21)20-16-13-12-14-17(20)5-2/h17-18H,4-16H2,1-3H3 |
| InChIKey | NIIAOYMEVWBWHZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undecan-3-yl 2-ethylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undecan-3-yl 2-ethylpiperidine-1-carboxylate?
The IUPAC name of undecan-3-yl 2-ethylpiperidine-1-carboxylate (CID 175325020) is undecan-3-yl 2-ethylpiperidine-1-carboxylate.
What is the SMILES notation for undecan-3-yl 2-ethylpiperidine-1-carboxylate?
The canonical SMILES for undecan-3-yl 2-ethylpiperidine-1-carboxylate is CCCCCCCCC(CC)OC(=O)N1CCCCC1CC.
What is the InChIKey of undecan-3-yl 2-ethylpiperidine-1-carboxylate?
The InChIKey is NIIAOYMEVWBWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO2/c1-4-7-8-9-10-11-15-18(6-3)22-19(21)20-16-13-12-14-17(20)5-2/h17-18H,4-16H2,1-3H3.
What are the key properties of undecan-3-yl 2-ethylpiperidine-1-carboxylate?
undecan-3-yl 2-ethylpiperidine-1-carboxylate has a molecular weight of 311.51 g/mol, XLogP of 5.92, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for undecan-3-yl 2-ethylpiperidine-1-carboxylate is sourced from PubChem (CID 175325020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).