About tetradecan-3-yl cyclobutanecarboxylate
tetradecan-3-yl cyclobutanecarboxylate (PubChem CID 544011) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is tetradecan-3-yl cyclobutanecarboxylate.
Molecular Properties
| Compound Name | tetradecan-3-yl cyclobutanecarboxylate |
| PubChem CID | 544011 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | tetradecan-3-yl cyclobutanecarboxylate |
| SMILES | CCCCCCCCCCCC(CC)OC(=O)C1CCC1 |
| InChI | InChI=1S/C19H36O2/c1-3-5-6-7-8-9-10-11-12-16-18(4-2)21-19(20)17-14-13-15-17/h17-18H,3-16H2,1-2H3 |
| InChIKey | ALCZMJKWIXEEDY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecan-3-yl cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecan-3-yl cyclobutanecarboxylate?
The IUPAC name of tetradecan-3-yl cyclobutanecarboxylate (CID 544011) is tetradecan-3-yl cyclobutanecarboxylate.
What is the SMILES notation for tetradecan-3-yl cyclobutanecarboxylate?
The canonical SMILES for tetradecan-3-yl cyclobutanecarboxylate is CCCCCCCCCCCC(CC)OC(=O)C1CCC1.
What is the InChIKey of tetradecan-3-yl cyclobutanecarboxylate?
The InChIKey is ALCZMJKWIXEEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-3-5-6-7-8-9-10-11-12-16-18(4-2)21-19(20)17-14-13-15-17/h17-18H,3-16H2,1-2H3.
What are the key properties of tetradecan-3-yl cyclobutanecarboxylate?
tetradecan-3-yl cyclobutanecarboxylate has a molecular weight of 296.50 g/mol, XLogP of 6.03, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecan-3-yl cyclobutanecarboxylate is sourced from PubChem (CID 544011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).