C26H32N4O4 — CID 175327963
[2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl N-tert-butylcarbamate (PubChem CID 175327963) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is [2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl N-tert-butylcarbamate.
| Compound Name | [2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175327963 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [2-[bis[(4-methoxyphenyl)methyl]amino]pyrimidin-4-yl]methyl N-tert-butylcarbamate |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nccc(COC(=O)NC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C26H32N4O4/c1-26(2,3)29-25(31)34-18-21-14-15-27-24(28-21)30(16-19-6-10-22(32-4)11-7-19)17-20-8-12-23(33-5)13-9-20/h6-15H,16-18H2,1-5H3,(H,29,31) |
| InChIKey | RPPKNSWEKAPVBX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |