C21H24N4O2 — CID 134264948
4-(aminomethyl)-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine (PubChem CID 134264948) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-(aminomethyl)-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134264948 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-(aminomethyl)-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nccc(CN)n2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-26-19-7-3-16(4-8-19)14-25(21-23-12-11-18(13-22)24-21)15-17-5-9-20(27-2)10-6-17/h3-12H,13-15,22H2,1-2H3 |
| InChIKey | GJQMUXLXBPMVHN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |