C12H8N2O5S3 — CID 175328937
2-[1-benzothiophen-3-yl(sulfo)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 175328937) has the molecular formula C12H8N2O5S3 and a molecular weight of 356.41 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-yl(sulfo)amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-benzothiophen-3-yl(sulfo)amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175328937 |
| Molecular Formula | C12H8N2O5S3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 2-[1-benzothiophen-3-yl(sulfo)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(N(c2csc3ccccc23)S(=O)(=O)O)n1 |
| InChI | InChI=1S/C12H8N2O5S3/c15-11(16)8-5-21-12(13-8)14(22(17,18)19)9-6-20-10-4-2-1-3-7(9)10/h1-6H,(H,15,16)(H,17,18,19) |
| InChIKey | GOUSLVZPCABYJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|