C12H12N2O6S2 — CID 174961413
2-[2-phenoxyethyl(sulfo)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 174961413) has the molecular formula C12H12N2O6S2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[2-phenoxyethyl(sulfo)amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-phenoxyethyl(sulfo)amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174961413 |
| Molecular Formula | C12H12N2O6S2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-[2-phenoxyethyl(sulfo)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(N(CCOc2ccccc2)S(=O)(=O)O)n1 |
| InChI | InChI=1S/C12H12N2O6S2/c15-11(16)10-8-21-12(13-10)14(22(17,18)19)6-7-20-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,15,16)(H,17,18,19) |
| InChIKey | VYEKUFFRTCNXPQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|