About 3-nitrosobenzene-1,2-dicarbonyl chloride
3-nitrosobenzene-1,2-dicarbonyl chloride (PubChem CID 175328999) has the molecular formula C8H3Cl2NO3
and a molecular weight of 232.02 g/mol. Its IUPAC name is 3-nitrosobenzene-1,2-dicarbonyl chloride.
Molecular Properties
| Compound Name | 3-nitrosobenzene-1,2-dicarbonyl chloride |
| PubChem CID | 175328999 |
| Molecular Formula | C8H3Cl2NO3 |
| Molecular Weight | 232.02 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 3-nitrosobenzene-1,2-dicarbonyl chloride |
| SMILES | O=Nc1cccc(C(=O)Cl)c1C(=O)Cl |
| InChI | InChI=1S/C8H3Cl2NO3/c9-7(12)4-2-1-3-5(11-14)6(4)8(10)13/h1-3H |
| InChIKey | WBGXOJFKBQABFR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.02 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrosobenzene-1,2-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosobenzene-1,2-dicarbonyl chloride?
The IUPAC name of 3-nitrosobenzene-1,2-dicarbonyl chloride (CID 175328999) is 3-nitrosobenzene-1,2-dicarbonyl chloride.
What is the SMILES notation for 3-nitrosobenzene-1,2-dicarbonyl chloride?
The canonical SMILES for 3-nitrosobenzene-1,2-dicarbonyl chloride is O=Nc1cccc(C(=O)Cl)c1C(=O)Cl.
What is the InChIKey of 3-nitrosobenzene-1,2-dicarbonyl chloride?
The InChIKey is WBGXOJFKBQABFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl2NO3/c9-7(12)4-2-1-3-5(11-14)6(4)8(10)13/h1-3H.
What are the key properties of 3-nitrosobenzene-1,2-dicarbonyl chloride?
3-nitrosobenzene-1,2-dicarbonyl chloride has a molecular weight of 232.02 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosobenzene-1,2-dicarbonyl chloride is sourced from PubChem (CID 175328999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).