C20H28O8 — CID 175329312
4-methyl-2-(2-methyl-3-prop-2-enoyloxypropyl)-5-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)pentanoic acid (PubChem CID 175329312) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-methyl-2-(2-methyl-3-prop-2-enoyloxypropyl)-5-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)pentanoic acid.
| Compound Name | 4-methyl-2-(2-methyl-3-prop-2-enoyloxypropyl)-5-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 175329312 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-methyl-2-(2-methyl-3-prop-2-enoyloxypropyl)-5-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)pentanoic acid |
| SMILES | C=CC(=O)OCC(C)CC(COC(=O)C=C)(CC(C)COC(=O)C=C)C(=O)O |
| InChI | InChI=1S/C20H28O8/c1-6-16(21)26-11-14(4)9-20(19(24)25,13-28-18(23)8-3)10-15(5)12-27-17(22)7-2/h6-8,14-15H,1-3,9-13H2,4-5H3,(H,24,25) |
| InChIKey | OZYBUXJKLGUSAT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|