C10H8BrFO3S — CID 175332350
7-bromo-5-fluoro-4-methylsulfonyl-1,3-dihydroinden-2-one (PubChem CID 175332350) has the molecular formula C10H8BrFO3S and a molecular weight of 307.14 g/mol. Its IUPAC name is 7-bromo-5-fluoro-4-methylsulfonyl-1,3-dihydroinden-2-one.
| Compound Name | 7-bromo-5-fluoro-4-methylsulfonyl-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 175332350 |
| Molecular Formula | C10H8BrFO3S |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 7-bromo-5-fluoro-4-methylsulfonyl-1,3-dihydroinden-2-one |
| SMILES | CS(=O)(=O)c1c(F)cc(Br)c2c1CC(=O)C2 |
| InChI | InChI=1S/C10H8BrFO3S/c1-16(14,15)10-7-3-5(13)2-6(7)8(11)4-9(10)12/h4H,2-3H2,1H3 |
| InChIKey | MZFBTPAWPXZIMG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |