C10H6F3NSe — CID 175333276
3-[4-(trifluoromethyl)phenyl]-1,2-selenazole (PubChem CID 175333276) has the molecular formula C10H6F3NSe and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-1,2-selenazole.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-1,2-selenazole |
|---|---|
| PubChem CID | 175333276 |
| Molecular Formula | C10H6F3NSe |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-1,2-selenazole |
| SMILES | FC(F)(F)c1ccc(-c2cc[se]n2)cc1 |
| InChI | InChI=1S/C10H6F3NSe/c11-10(12,13)8-3-1-7(2-4-8)9-5-6-15-14-9/h1-6H |
| InChIKey | QOBLNGZTTCHTTI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|