C28H23N3O3S — CID 175333524
8-acetamido-7-(naphthalen-1-ylmethyl)-5-oxo-N-phenyl-1-sulfanylidene-2,3-dihydroindolizine-3-carboxamide (PubChem CID 175333524) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 8-acetamido-7-(naphthalen-1-ylmethyl)-5-oxo-N-phenyl-1-sulfanylidene-2,3-dihydroindolizine-3-carboxamide.
| Compound Name | 8-acetamido-7-(naphthalen-1-ylmethyl)-5-oxo-N-phenyl-1-sulfanylidene-2,3-dihydroindolizine-3-carboxamide |
|---|---|
| PubChem CID | 175333524 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 8-acetamido-7-(naphthalen-1-ylmethyl)-5-oxo-N-phenyl-1-sulfanylidene-2,3-dihydroindolizine-3-carboxamide |
| SMILES | CC(=O)Nc1c(Cc2cccc3ccccc23)cc(=O)n2c1C(=S)CC2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H23N3O3S/c1-17(32)29-26-20(14-19-10-7-9-18-8-5-6-13-22(18)19)15-25(33)31-23(16-24(35)27(26)31)28(34)30-21-11-3-2-4-12-21/h2-13,15,23H,14,16H2,1H3,(H,29,32)(H,30,34) |
| InChIKey | KTFWMPFRHVLFAT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|