C8H16O7S2 — CID 175335034
6-hydroxy-4,4-dimethyl-5,6-disulfinohexanoic acid (PubChem CID 175335034) has the molecular formula C8H16O7S2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 6-hydroxy-4,4-dimethyl-5,6-disulfinohexanoic acid.
| Compound Name | 6-hydroxy-4,4-dimethyl-5,6-disulfinohexanoic acid |
|---|---|
| PubChem CID | 175335034 |
| Molecular Formula | C8H16O7S2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 6-hydroxy-4,4-dimethyl-5,6-disulfinohexanoic acid |
| SMILES | CC(C)(CCC(=O)O)C(C(O)S(=O)O)S(=O)O |
| InChI | InChI=1S/C8H16O7S2/c1-8(2,4-3-5(9)10)6(16(12)13)7(11)17(14)15/h6-7,11H,3-4H2,1-2H3,(H,9,10)(H,12,13)(H,14,15) |
| InChIKey | ZIYQPAGBIDRYRN-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|