C26H30F4N4O2 — CID 175336958
propan-2-yl 1-(2-fluoro-4-pyridinyl)-6-methyl-5-[1-[4-(1,2,2-trifluoroethyl)piperazin-1-yl]ethyl]indolizine-7-carboxylate (PubChem CID 175336958) has the molecular formula C26H30F4N4O2 and a molecular weight of 506.54 g/mol. Its IUPAC name is propan-2-yl 1-(2-fluoro-4-pyridinyl)-6-methyl-5-[1-[4-(1,2,2-trifluoroethyl)piperazin-1-yl]ethyl]indolizine-7-carboxylate.
| Compound Name | propan-2-yl 1-(2-fluoro-4-pyridinyl)-6-methyl-5-[1-[4-(1,2,2-trifluoroethyl)piperazin-1-yl]ethyl]indolizine-7-carboxylate |
|---|---|
| PubChem CID | 175336958 |
| Molecular Formula | C26H30F4N4O2 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | propan-2-yl 1-(2-fluoro-4-pyridinyl)-6-methyl-5-[1-[4-(1,2,2-trifluoroethyl)piperazin-1-yl]ethyl]indolizine-7-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)cc2c(-c3ccnc(F)c3)ccn2c1C(C)N1CCN(C(F)C(F)F)CC1 |
| InChI | InChI=1S/C26H30F4N4O2/c1-15(2)36-26(35)20-14-21-19(18-5-7-31-22(27)13-18)6-8-34(21)23(16(20)3)17(4)32-9-11-33(12-10-32)25(30)24(28)29/h5-8,13-15,17,24-25H,9-12H2,1-4H3 |
| InChIKey | VJACLKLZLQABEK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|