C25H30N2O3 — CID 139311524
propan-2-yl 6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carboxylate (PubChem CID 139311524) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is propan-2-yl 6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carboxylate.
| Compound Name | propan-2-yl 6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carboxylate |
|---|---|
| PubChem CID | 139311524 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | propan-2-yl 6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)cc2c(-c3ccccc3)ccn2c1C(C)N1CCOCC1 |
| InChI | InChI=1S/C25H30N2O3/c1-17(2)30-25(28)22-16-23-21(20-8-6-5-7-9-20)10-11-27(23)24(18(22)3)19(4)26-12-14-29-15-13-26/h5-11,16-17,19H,12-15H2,1-4H3 |
| InChIKey | SUMUOEHIKNXQAO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |