C23H28N2O3 — CID 142300594
methanol;6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carbaldehyde (PubChem CID 142300594) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is methanol;6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carbaldehyde.
| Compound Name | methanol;6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carbaldehyde |
|---|---|
| PubChem CID | 142300594 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | methanol;6-methyl-5-(1-morpholin-4-ylethyl)-1-phenylindolizine-7-carbaldehyde |
| SMILES | CO.Cc1c(C=O)cc2c(-c3ccccc3)ccn2c1C(C)N1CCOCC1 |
| InChI | InChI=1S/C22H24N2O2.CH4O/c1-16-19(15-25)14-21-20(18-6-4-3-5-7-18)8-9-24(21)22(16)17(2)23-10-12-26-13-11-23;1-2/h3-9,14-15,17H,10-13H2,1-2H3;2H,1H3 |
| InChIKey | FLLQRRHQDMPCBS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|