About ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine
ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine (PubChem CID 143797023) has the molecular formula C22H38N2O3
and a molecular weight of 378.56 g/mol. Its IUPAC name is ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine.
Molecular Properties
| Compound Name | ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine |
| PubChem CID | 143797023 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine |
| SMILES | CC.CNC1CCOCC1.Cc1ccc(C(C)N2CCOCC2)cc1C=O |
| InChI | InChI=1S/C14H19NO2.C6H13NO.C2H6/c1-11-3-4-13(9-14(11)10-16)12(2)15-5-7-17-8-6-15;1-7-6-2-4-8-5-3-6;1-2/h3-4,9-10,12H,5-8H2,1-2H3;6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | IPFXTGCNJFSFSM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine?
The IUPAC name of ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine (CID 143797023) is ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine.
What is the SMILES notation for ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine?
The canonical SMILES for ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine is CC.CNC1CCOCC1.Cc1ccc(C(C)N2CCOCC2)cc1C=O.
What is the InChIKey of ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine?
The InChIKey is IPFXTGCNJFSFSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2.C6H13NO.C2H6/c1-11-3-4-13(9-14(11)10-16)12(2)15-5-7-17-8-6-15;1-7-6-2-4-8-5-3-6;1-2/h3-4,9-10,12H,5-8H2,1-2H3;6-7H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine?
ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine has a molecular weight of 378.56 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5-(1-morpholin-4-ylethyl)benzaldehyde;N-methyloxan-4-amine is sourced from PubChem (CID 143797023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).