C17H20N2O3 — CID 175337447
[3-(hydroxymethyl)-4-[(3S)-3-pyridin-2-yloxypyrrolidin-1-yl]phenyl]methanol (PubChem CID 175337447) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is [3-(hydroxymethyl)-4-[(3S)-3-pyridin-2-yloxypyrrolidin-1-yl]phenyl]methanol.
| Compound Name | [3-(hydroxymethyl)-4-[(3S)-3-pyridin-2-yloxypyrrolidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 175337447 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [3-(hydroxymethyl)-4-[(3S)-3-pyridin-2-yloxypyrrolidin-1-yl]phenyl]methanol |
| SMILES | OCc1ccc(N2CC[C@H](Oc3ccccn3)C2)c(CO)c1 |
| InChI | InChI=1S/C17H20N2O3/c20-11-13-4-5-16(14(9-13)12-21)19-8-6-15(10-19)22-17-3-1-2-7-18-17/h1-5,7,9,15,20-21H,6,8,10-12H2/t15-/m0/s1 |
| InChIKey | CBJJUAAJWFCXGN-HNNXBMFYSA-N |
| XLogP | 1.72 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|