C17H25N5O2 — CID 175337657
tert-butyl 2,3-bis(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate (PubChem CID 175337657) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl 2,3-bis(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2,3-bis(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175337657 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | tert-butyl 2,3-bis(4-methyl-1H-pyrazol-5-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cn[nH]c1C1CCN(C(=O)OC(C)(C)C)C1c1[nH]ncc1C |
| InChI | InChI=1S/C17H25N5O2/c1-10-8-18-20-13(10)12-6-7-22(16(23)24-17(3,4)5)15(12)14-11(2)9-19-21-14/h8-9,12,15H,6-7H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | QXYJEXNXCHSNDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |