C14H16F4N4O — CID 175337910
(E)-2-(aminomethyl)-3-fluoro-1-[2-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-5-yl]prop-2-en-1-one (PubChem CID 175337910) has the molecular formula C14H16F4N4O and a molecular weight of 332.30 g/mol. Its IUPAC name is (E)-2-(aminomethyl)-3-fluoro-1-[2-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-5-yl]prop-2-en-1-one.
| Compound Name | (E)-2-(aminomethyl)-3-fluoro-1-[2-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175337910 |
| Molecular Formula | C14H16F4N4O |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (E)-2-(aminomethyl)-3-fluoro-1-[2-[4-(trifluoromethyl)piperidin-1-yl]pyrimidin-5-yl]prop-2-en-1-one |
| SMILES | NC/C(=C\F)C(=O)c1cnc(N2CCC(C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C14H16F4N4O/c15-5-9(6-19)12(23)10-7-20-13(21-8-10)22-3-1-11(2-4-22)14(16,17)18/h5,7-8,11H,1-4,6,19H2/b9-5+ |
| InChIKey | QYLXOFJOFFQWIQ-WEVVVXLNSA-N |
| XLogP | 2.25 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|