About 6,6-dihexyloxatellurane
6,6-dihexyloxatellurane (PubChem CID 175339145) has the molecular formula C16H32OTe
and a molecular weight of 368.03 g/mol. Its IUPAC name is 6,6-dihexyloxatellurane.
Molecular Properties
| Compound Name | 6,6-dihexyloxatellurane |
| PubChem CID | 175339145 |
| Molecular Formula | C16H32OTe |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 6,6-dihexyloxatellurane |
| SMILES | CCCCCCC1(CCCCCC)CCC[Te]O1 |
| InChI | InChI=1S/C16H32OTe/c1-3-5-7-9-12-16(13-10-8-6-4-2)14-11-15-18-17-16/h3-15H2,1-2H3 |
| InChIKey | GRRYMQSOHGGYLA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dihexyloxatellurane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dihexyloxatellurane?
The IUPAC name of 6,6-dihexyloxatellurane (CID 175339145) is 6,6-dihexyloxatellurane.
What is the SMILES notation for 6,6-dihexyloxatellurane?
The canonical SMILES for 6,6-dihexyloxatellurane is CCCCCCC1(CCCCCC)CCC[Te]O1.
What is the InChIKey of 6,6-dihexyloxatellurane?
The InChIKey is GRRYMQSOHGGYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32OTe/c1-3-5-7-9-12-16(13-10-8-6-4-2)14-11-15-18-17-16/h3-15H2,1-2H3.
What are the key properties of 6,6-dihexyloxatellurane?
6,6-dihexyloxatellurane has a molecular weight of 368.03 g/mol, XLogP of 5.51, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dihexyloxatellurane is sourced from PubChem (CID 175339145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).