About hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride
hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride (PubChem CID 175341292) has the molecular formula C8H16ClNO3
and a molecular weight of 209.67 g/mol. Its IUPAC name is hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride |
| PubChem CID | 175341292 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride |
| SMILES | CCN1CCC(C(=O)OCO)C1.Cl |
| InChI | InChI=1S/C8H15NO3.ClH/c1-2-9-4-3-7(5-9)8(11)12-6-10;/h7,10H,2-6H2,1H3;1H |
| InChIKey | WLFPAJWHHRJDRG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride?
The IUPAC name of hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride (CID 175341292) is hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride.
What is the SMILES notation for hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride?
The canonical SMILES for hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride is CCN1CCC(C(=O)OCO)C1.Cl.
What is the InChIKey of hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride?
The InChIKey is WLFPAJWHHRJDRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3.ClH/c1-2-9-4-3-7(5-9)8(11)12-6-10;/h7,10H,2-6H2,1H3;1H.
What are the key properties of hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride?
hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride has a molecular weight of 209.67 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl 1-ethylpyrrolidine-3-carboxylate;hydrochloride is sourced from PubChem (CID 175341292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).