About [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate
[phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate (PubChem CID 175341483) has the molecular formula C27H21NO3
and a molecular weight of 407.47 g/mol. Its IUPAC name is [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate |
| PubChem CID | 175341483 |
| Molecular Formula | C27H21NO3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1-c1ccncc1)OC(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21NO3/c29-26(16-15-21-9-7-8-14-25(21)22-17-19-28-20-18-22)31-27(23-10-3-1-4-11-23)30-24-12-5-2-6-13-24/h1-20,27H/b16-15+ |
| InChIKey | MMMJYUZSZGLMCY-FOCLMDBBSA-N |
| XLogP | 6.08 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate?
The IUPAC name of [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate (CID 175341483) is [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate.
What is the SMILES notation for [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate?
The canonical SMILES for [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate is O=C(/C=C/c1ccccc1-c1ccncc1)OC(Oc1ccccc1)c1ccccc1.
What is the InChIKey of [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate?
The InChIKey is MMMJYUZSZGLMCY-FOCLMDBBSA-N. The full InChI is InChI=1S/C27H21NO3/c29-26(16-15-21-9-7-8-14-25(21)22-17-19-28-20-18-22)31-27(23-10-3-1-4-11-23)30-24-12-5-2-6-13-24/h1-20,27H/b16-15+.
What are the key properties of [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate?
[phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate has a molecular weight of 407.47 g/mol, XLogP of 6.08, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [phenoxy(phenyl)methyl] (E)-3-(2-pyridin-4-ylphenyl)prop-2-enoate is sourced from PubChem (CID 175341483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).