C14H21N3O2 — CID 175343955
tert-butyl 2,3-bis(cyanomethyl)piperidine-1-carboxylate (PubChem CID 175343955) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl 2,3-bis(cyanomethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2,3-bis(cyanomethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175343955 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | tert-butyl 2,3-bis(cyanomethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CC#N)C1CC#N |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,3)19-13(18)17-10-4-5-11(6-8-15)12(17)7-9-16/h11-12H,4-7,10H2,1-3H3 |
| InChIKey | DUHCRXXXSJUIBF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |