About bis(tert-butylbenzene);imino(oxo)zirconium
bis(tert-butylbenzene);imino(oxo)zirconium (PubChem CID 175344733) has the molecular formula C20H27NOZr-2
and a molecular weight of 388.67 g/mol. Its IUPAC name is bis(tert-butylbenzene);imino(oxo)zirconium.
Molecular Properties
| Compound Name | bis(tert-butylbenzene);imino(oxo)zirconium |
| PubChem CID | 175344733 |
| Molecular Formula | C20H27NOZr-2 |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | bis(tert-butylbenzene);imino(oxo)zirconium |
| SMILES | CC(C)(C)c1[c-]cccc1.CC(C)(C)c1[c-]cccc1.N=[Zr]=O |
| InChI | InChI=1S/2C10H13.HN.O.Zr/c2*1-10(2,3)9-7-5-4-6-8-9;;;/h2*4-7H,1-3H3;1H;;/q2*-1;;; |
| InChIKey | CBPQMOGYWVMWCL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butylbenzene);imino(oxo)zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butylbenzene);imino(oxo)zirconium?
The IUPAC name of bis(tert-butylbenzene);imino(oxo)zirconium (CID 175344733) is bis(tert-butylbenzene);imino(oxo)zirconium.
What is the SMILES notation for bis(tert-butylbenzene);imino(oxo)zirconium?
The canonical SMILES for bis(tert-butylbenzene);imino(oxo)zirconium is CC(C)(C)c1[c-]cccc1.CC(C)(C)c1[c-]cccc1.N=[Zr]=O.
What is the InChIKey of bis(tert-butylbenzene);imino(oxo)zirconium?
The InChIKey is CBPQMOGYWVMWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13.HN.O.Zr/c2*1-10(2,3)9-7-5-4-6-8-9;;;/h2*4-7H,1-3H3;1H;;/q2*-1;;;.
What are the key properties of bis(tert-butylbenzene);imino(oxo)zirconium?
bis(tert-butylbenzene);imino(oxo)zirconium has a molecular weight of 388.67 g/mol, XLogP of 5.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butylbenzene);imino(oxo)zirconium is sourced from PubChem (CID 175344733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).