C22H17N7O3 — CID 175346570
carbamoyl 8-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,7-naphthyridine-6-carboxylate (PubChem CID 175346570) has the molecular formula C22H17N7O3 and a molecular weight of 427.42 g/mol. Its IUPAC name is carbamoyl 8-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,7-naphthyridine-6-carboxylate.
| Compound Name | carbamoyl 8-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,7-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 175346570 |
| Molecular Formula | C22H17N7O3 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | carbamoyl 8-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]-1,7-naphthyridine-6-carboxylate |
| SMILES | Cn1cc(-c2nn(C)c3ccc(-c4nc(C(=O)OC(N)=O)cc5cccnc45)cc23)cn1 |
| InChI | InChI=1S/C22H17N7O3/c1-28-11-14(10-25-28)18-15-8-13(5-6-17(15)29(2)27-18)20-19-12(4-3-7-24-19)9-16(26-20)21(30)32-22(23)31/h3-11H,1-2H3,(H2,23,31) |
| InChIKey | FYTMQOCPNCSQLB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|