C14H16N4S — CID 176982722
1-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]ethanethiol (PubChem CID 176982722) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 1-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]ethanethiol.
| Compound Name | 1-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]ethanethiol |
|---|---|
| PubChem CID | 176982722 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-[1-methyl-3-(1-methylpyrazol-4-yl)indazol-5-yl]ethanethiol |
| SMILES | CC(S)c1ccc2c(c1)c(-c1cnn(C)c1)nn2C |
| InChI | InChI=1S/C14H16N4S/c1-9(19)10-4-5-13-12(6-10)14(16-18(13)3)11-7-15-17(2)8-11/h4-9,19H,1-3H3 |
| InChIKey | HJJRKJNZEVWFPP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|