C28H47N3O3S — CID 175352808
[1-benzyl-4-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-2-yl]sulfamic acid (PubChem CID 175352808) has the molecular formula C28H47N3O3S and a molecular weight of 505.77 g/mol. Its IUPAC name is [1-benzyl-4-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-2-yl]sulfamic acid.
| Compound Name | [1-benzyl-4-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 175352808 |
| Molecular Formula | C28H47N3O3S |
| Molecular Weight | 505.77 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | [1-benzyl-4-[(Z)-octadec-9-enyl]-4,5-dihydroimidazol-2-yl]sulfamic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC1CN(Cc2ccccc2)C(NS(=O)(=O)O)=N1 |
| InChI | InChI=1S/C28H47N3O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-27-25-31(24-26-21-18-17-19-22-26)28(29-27)30-35(32,33)34/h9-10,17-19,21-22,27H,2-8,11-16,20,23-25H2,1H3,(H,29,30)(H,32,33,34)/b10-9- |
| InChIKey | WHCDSQJYTZDTPR-KTKRTIGZSA-N |
| XLogP | 7.05 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|