C26H22F3N3O3 — CID 175353078
4-[1-[[1-methyl-3-[4-(trifluoromethyl)anilino]indole-2-carbonyl]amino]ethyl]benzoic acid (PubChem CID 175353078) has the molecular formula C26H22F3N3O3 and a molecular weight of 481.47 g/mol. Its IUPAC name is 4-[1-[[1-methyl-3-[4-(trifluoromethyl)anilino]indole-2-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[1-methyl-3-[4-(trifluoromethyl)anilino]indole-2-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175353078 |
| Molecular Formula | C26H22F3N3O3 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-[1-[[1-methyl-3-[4-(trifluoromethyl)anilino]indole-2-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)c1c(Nc2ccc(C(F)(F)F)cc2)c2ccccc2n1C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H22F3N3O3/c1-15(16-7-9-17(10-8-16)25(34)35)30-24(33)23-22(20-5-3-4-6-21(20)32(23)2)31-19-13-11-18(12-14-19)26(27,28)29/h3-15,31H,1-2H3,(H,30,33)(H,34,35) |
| InChIKey | BPNWKHVJERWBIT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |