C31H27N3O3 — CID 175112191
4-[(1S)-1-[[1-methyl-3-(3-phenylanilino)indole-2-carbonyl]amino]ethyl]benzoic acid (PubChem CID 175112191) has the molecular formula C31H27N3O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 4-[(1S)-1-[[1-methyl-3-(3-phenylanilino)indole-2-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[1-methyl-3-(3-phenylanilino)indole-2-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175112191 |
| Molecular Formula | C31H27N3O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 4-[(1S)-1-[[1-methyl-3-(3-phenylanilino)indole-2-carbonyl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1c(Nc2cccc(-c3ccccc3)c2)c2ccccc2n1C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H27N3O3/c1-20(21-15-17-23(18-16-21)31(36)37)32-30(35)29-28(26-13-6-7-14-27(26)34(29)2)33-25-12-8-11-24(19-25)22-9-4-3-5-10-22/h3-20,33H,1-2H3,(H,32,35)(H,36,37)/t20-/m0/s1 |
| InChIKey | MMTBDCGZSWMPEV-FQEVSTJZSA-N |
| XLogP | 6.78 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |