C24H25NO6S — CID 175353502
4-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-4-oxobutanoic acid (PubChem CID 175353502) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-4-oxobutanoic acid.
| Compound Name | 4-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175353502 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)N(OCc1ccccc1)C(CC(=O)c1cc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C24H25NO6S/c1-24(2,3)31-23(29)25(30-15-16-9-5-4-6-10-16)18(22(27)28)14-19(26)21-13-17-11-7-8-12-20(17)32-21/h4-13,18H,14-15H2,1-3H3,(H,27,28) |
| InChIKey | HMMKMVACXBZRPD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|