C19H25N7 — CID 175354559
6-[1-(2-phenylimidazol-1-yl)heptyl]-1,3,5-triazine-2,4-diamine (PubChem CID 175354559) has the molecular formula C19H25N7 and a molecular weight of 351.46 g/mol. Its IUPAC name is 6-[1-(2-phenylimidazol-1-yl)heptyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-(2-phenylimidazol-1-yl)heptyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 175354559 |
| Molecular Formula | C19H25N7 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 6-[1-(2-phenylimidazol-1-yl)heptyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCC(c1nc(N)nc(N)n1)n1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C19H25N7/c1-2-3-4-8-11-15(16-23-18(20)25-19(21)24-16)26-13-12-22-17(26)14-9-6-5-7-10-14/h5-7,9-10,12-13,15H,2-4,8,11H2,1H3,(H4,20,21,23,24,25) |
| InChIKey | JXVCNLPQALOGSO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|