C29H44N2O4 — CID 132539980
bis(2-ethylhexyl) 2-(2-phenylimidazol-1-yl)butanedioate (PubChem CID 132539980) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-(2-phenylimidazol-1-yl)butanedioate.
| Compound Name | bis(2-ethylhexyl) 2-(2-phenylimidazol-1-yl)butanedioate |
|---|---|
| PubChem CID | 132539980 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | bis(2-ethylhexyl) 2-(2-phenylimidazol-1-yl)butanedioate |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)n1ccnc1-c1ccccc1 |
| InChI | InChI=1S/C29H44N2O4/c1-5-9-14-23(7-3)21-34-27(32)20-26(29(33)35-22-24(8-4)15-10-6-2)31-19-18-30-28(31)25-16-12-11-13-17-25/h11-13,16-19,23-24,26H,5-10,14-15,20-22H2,1-4H3 |
| InChIKey | IBSBSUPWDXWAOT-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |