C21H19O10P — CID 175355293
2-(3,5-dihydroxyphenyl)-4,6-dihydroxy-3-(4-hydroxyphenyl)-2,3-dihydroinden-1-one;phosphoric acid (PubChem CID 175355293) has the molecular formula C21H19O10P and a molecular weight of 462.35 g/mol. Its IUPAC name is 2-(3,5-dihydroxyphenyl)-4,6-dihydroxy-3-(4-hydroxyphenyl)-2,3-dihydroinden-1-one;phosphoric acid.
| Compound Name | 2-(3,5-dihydroxyphenyl)-4,6-dihydroxy-3-(4-hydroxyphenyl)-2,3-dihydroinden-1-one;phosphoric acid |
|---|---|
| PubChem CID | 175355293 |
| Molecular Formula | C21H19O10P |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-(3,5-dihydroxyphenyl)-4,6-dihydroxy-3-(4-hydroxyphenyl)-2,3-dihydroinden-1-one;phosphoric acid |
| SMILES | O=C1c2cc(O)cc(O)c2C(c2ccc(O)cc2)C1c1cc(O)cc(O)c1.O=P(O)(O)O |
| InChI | InChI=1S/C21H16O6.H3O4P/c22-12-3-1-10(2-4-12)18-19(11-5-13(23)7-14(24)6-11)21(27)16-8-15(25)9-17(26)20(16)18;1-5(2,3)4/h1-9,18-19,22-26H;(H3,1,2,3,4) |
| InChIKey | ZJGNSKDRWJAANA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|