About (naphthalen-2-ylamino) 2-aminobenzoate
(naphthalen-2-ylamino) 2-aminobenzoate (PubChem CID 175356662) has the molecular formula C17H14N2O2
and a molecular weight of 278.31 g/mol. Its IUPAC name is (naphthalen-2-ylamino) 2-aminobenzoate.
Molecular Properties
| Compound Name | (naphthalen-2-ylamino) 2-aminobenzoate |
| PubChem CID | 175356662 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (naphthalen-2-ylamino) 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)ONc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H14N2O2/c18-16-8-4-3-7-15(16)17(20)21-19-14-10-9-12-5-1-2-6-13(12)11-14/h1-11,19H,18H2 |
| InChIKey | NNHQASIVXOWZRS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (naphthalen-2-ylamino) 2-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (naphthalen-2-ylamino) 2-aminobenzoate?
The IUPAC name of (naphthalen-2-ylamino) 2-aminobenzoate (CID 175356662) is (naphthalen-2-ylamino) 2-aminobenzoate.
What is the SMILES notation for (naphthalen-2-ylamino) 2-aminobenzoate?
The canonical SMILES for (naphthalen-2-ylamino) 2-aminobenzoate is Nc1ccccc1C(=O)ONc1ccc2ccccc2c1.
What is the InChIKey of (naphthalen-2-ylamino) 2-aminobenzoate?
The InChIKey is NNHQASIVXOWZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2/c18-16-8-4-3-7-15(16)17(20)21-19-14-10-9-12-5-1-2-6-13(12)11-14/h1-11,19H,18H2.
What are the key properties of (naphthalen-2-ylamino) 2-aminobenzoate?
(naphthalen-2-ylamino) 2-aminobenzoate has a molecular weight of 278.31 g/mol, XLogP of 3.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (naphthalen-2-ylamino) 2-aminobenzoate is sourced from PubChem (CID 175356662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).