C21H31N3O6 — CID 175356954
4-amino-2-[(2-amino-3-methylbutanoyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-5-phenylpentanoic acid (PubChem CID 175356954) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-amino-2-[(2-amino-3-methylbutanoyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-5-phenylpentanoic acid.
| Compound Name | 4-amino-2-[(2-amino-3-methylbutanoyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 175356954 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-amino-2-[(2-amino-3-methylbutanoyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxo-5-phenylpentanoic acid |
| SMILES | CC(C)C(N)C(=O)N(C(=O)OC(C)(C)C)C(C(=O)O)C(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C21H31N3O6/c1-12(2)15(23)18(26)24(20(29)30-21(3,4)5)16(19(27)28)17(25)14(22)11-13-9-7-6-8-10-13/h6-10,12,14-16H,11,22-23H2,1-5H3,(H,27,28) |
| InChIKey | FYHSGYXKECAXME-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 153.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|