C16H25NO3S — CID 175356979
2-(2,2-dimethylpropyl)heptanoyl 1,3-thiazole-4-carboxylate (PubChem CID 175356979) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)heptanoyl 1,3-thiazole-4-carboxylate.
| Compound Name | 2-(2,2-dimethylpropyl)heptanoyl 1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 175356979 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-(2,2-dimethylpropyl)heptanoyl 1,3-thiazole-4-carboxylate |
| SMILES | CCCCCC(CC(C)(C)C)C(=O)OC(=O)c1cscn1 |
| InChI | InChI=1S/C16H25NO3S/c1-5-6-7-8-12(9-16(2,3)4)14(18)20-15(19)13-10-21-11-17-13/h10-12H,5-9H2,1-4H3 |
| InChIKey | GPOPRGQPHHIUQI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|