C32H41N5O6S2 — CID 175357734
tert-butyl (3R)-3-[[(5R,7R)-5,7,11-triamino-7-(4-tert-butylsulfonylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 175357734) has the molecular formula C32H41N5O6S2 and a molecular weight of 655.84 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(5R,7R)-5,7,11-triamino-7-(4-tert-butylsulfonylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(5R,7R)-5,7,11-triamino-7-(4-tert-butylsulfonylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175357734 |
| Molecular Formula | C32H41N5O6S2 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | tert-butyl (3R)-3-[[(5R,7R)-5,7,11-triamino-7-(4-tert-butylsulfonylphenyl)-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NC(=O)c2sc3c(N)ccc4c3c2[C@@H](N)C(=O)[C@@]4(N)c2ccc(S(=O)(=O)C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C32H41N5O6S2/c1-30(2,3)43-29(40)37-15-7-8-18(16-37)36-28(39)26-23-22-20(13-14-21(33)25(22)44-26)32(35,27(38)24(23)34)17-9-11-19(12-10-17)45(41,42)31(4,5)6/h9-14,18,24H,7-8,15-16,33-35H2,1-6H3,(H,36,39)/t18-,24-,32-/m1/s1 |
| InChIKey | ZTPPPXRQXFOXMH-SVMWOAKZSA-N |
| XLogP | 3.97 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|